C25H38O5Si — CID 15054805
ethyl 11-[tert-butyl(dimethyl)silyl]oxy-4-oxo-1,2,3,3a,6,7,8,9,9b,10-decahydroindeno[4,5-c]chromene-3b-carboxylate (PubChem CID 15054805) has the molecular formula C25H38O5Si and a molecular weight of 446.66 g/mol. Its IUPAC name is ethyl 11-[tert-butyl(dimethyl)silyl]oxy-4-oxo-1,2,3,3a,6,7,8,9,9b,10-decahydroindeno[4,5-c]chromene-3b-carboxylate.
| Compound Name | ethyl 11-[tert-butyl(dimethyl)silyl]oxy-4-oxo-1,2,3,3a,6,7,8,9,9b,10-decahydroindeno[4,5-c]chromene-3b-carboxylate |
|---|---|
| PubChem CID | 15054805 |
| Molecular Formula | C25H38O5Si |
| Molecular Weight | 446.66 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | ethyl 11-[tert-butyl(dimethyl)silyl]oxy-4-oxo-1,2,3,3a,6,7,8,9,9b,10-decahydroindeno[4,5-c]chromene-3b-carboxylate |
| SMILES | CCOC(=O)C12C(=O)OC3=C(CCCC3)C1CC(O[Si](C)(C)C(C)(C)C)=C1CCCC12 |
| InChI | InChI=1S/C25H38O5Si/c1-7-28-22(26)25-18-13-10-12-16(18)21(30-31(5,6)24(2,3)4)15-19(25)17-11-8-9-14-20(17)29-23(25)27/h18-19H,7-15H2,1-6H3 |
| InChIKey | ZLALFMUDZMAEOR-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.66 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|