C26H40O5Si — CID 15054806
ethyl 12-[tert-butyl(dimethyl)silyl]oxy-5-oxo-2,3,4,4a,7,8,9,10,10b,11-decahydro-1H-naphtho[1,2-c]chromene-4b-carboxylate (PubChem CID 15054806) has the molecular formula C26H40O5Si and a molecular weight of 460.69 g/mol. Its IUPAC name is ethyl 12-[tert-butyl(dimethyl)silyl]oxy-5-oxo-2,3,4,4a,7,8,9,10,10b,11-decahydro-1H-naphtho[1,2-c]chromene-4b-carboxylate.
| Compound Name | ethyl 12-[tert-butyl(dimethyl)silyl]oxy-5-oxo-2,3,4,4a,7,8,9,10,10b,11-decahydro-1H-naphtho[1,2-c]chromene-4b-carboxylate |
|---|---|
| PubChem CID | 15054806 |
| Molecular Formula | C26H40O5Si |
| Molecular Weight | 460.69 g/mol |
| Exact Mass | 460.26 |
| IUPAC Name | ethyl 12-[tert-butyl(dimethyl)silyl]oxy-5-oxo-2,3,4,4a,7,8,9,10,10b,11-decahydro-1H-naphtho[1,2-c]chromene-4b-carboxylate |
| SMILES | CCOC(=O)C12C(=O)OC3=C(CCCC3)C1CC(O[Si](C)(C)C(C)(C)C)=C1CCCCC12 |
| InChI | InChI=1S/C26H40O5Si/c1-7-29-23(27)26-19-14-10-8-12-17(19)22(31-32(5,6)25(2,3)4)16-20(26)18-13-9-11-15-21(18)30-24(26)28/h19-20H,7-16H2,1-6H3 |
| InChIKey | POHGAEARUDPBFP-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.69 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|