C16H12FN3O2 — CID 150552837
2-[(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one (PubChem CID 150552837) has the molecular formula C16H12FN3O2 and a molecular weight of 297.29 g/mol. Its IUPAC name is 2-[(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one.
| Compound Name | 2-[(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 150552837 |
| Molecular Formula | C16H12FN3O2 |
| Molecular Weight | 297.29 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 2-[(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one |
| SMILES | O=C1Nc2ccc(F)cc2C1=Cc1cc2c([nH]1)CCNC2=O |
| InChI | InChI=1S/C16H12FN3O2/c17-8-1-2-13-10(5-8)11(16(22)20-13)6-9-7-12-14(19-9)3-4-18-15(12)21/h1-2,5-7,19H,3-4H2,(H,18,21)(H,20,22) |
| InChIKey | IIFTZIDHPKNDRW-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.29 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|