C21H25N3O3 — CID 150605299
[1-[(2-hydroxy-2-phenylethyl)amino]-3-(1H-indol-3-yl)-2-methylpropan-2-yl]carbamic acid (PubChem CID 150605299) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is [1-[(2-hydroxy-2-phenylethyl)amino]-3-(1H-indol-3-yl)-2-methylpropan-2-yl]carbamic acid.
| Compound Name | [1-[(2-hydroxy-2-phenylethyl)amino]-3-(1H-indol-3-yl)-2-methylpropan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 150605299 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | [1-[(2-hydroxy-2-phenylethyl)amino]-3-(1H-indol-3-yl)-2-methylpropan-2-yl]carbamic acid |
| SMILES | CC(CNCC(O)c1ccccc1)(Cc1c[nH]c2ccccc12)NC(=O)O |
| InChI | InChI=1S/C21H25N3O3/c1-21(24-20(26)27,11-16-12-23-18-10-6-5-9-17(16)18)14-22-13-19(25)15-7-3-2-4-8-15/h2-10,12,19,22-25H,11,13-14H2,1H3,(H,26,27) |
| InChIKey | ISSZCZOKZVSTMB-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |