C30H31N7O — CID 150615182
1-[(3R)-3-[4-amino-6-[2-(1-aminocyclohexyl)ethynyl]-5-quinolin-3-ylpyrrolo[2,3-d]pyrimidin-7-yl]pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 150615182) has the molecular formula C30H31N7O and a molecular weight of 505.63 g/mol. Its IUPAC name is 1-[(3R)-3-[4-amino-6-[2-(1-aminocyclohexyl)ethynyl]-5-quinolin-3-ylpyrrolo[2,3-d]pyrimidin-7-yl]pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3R)-3-[4-amino-6-[2-(1-aminocyclohexyl)ethynyl]-5-quinolin-3-ylpyrrolo[2,3-d]pyrimidin-7-yl]pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 150615182 |
| Molecular Formula | C30H31N7O |
| Molecular Weight | 505.63 g/mol |
| Exact Mass | 505.26 |
| IUPAC Name | 1-[(3R)-3-[4-amino-6-[2-(1-aminocyclohexyl)ethynyl]-5-quinolin-3-ylpyrrolo[2,3-d]pyrimidin-7-yl]pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC[C@@H](n2c(C#CC3(N)CCCCC3)c(-c3cnc4ccccc4c3)c3c(N)ncnc32)C1 |
| InChI | InChI=1S/C30H31N7O/c1-2-25(38)36-15-11-22(18-36)37-24(10-14-30(32)12-6-3-7-13-30)26(27-28(31)34-19-35-29(27)37)21-16-20-8-4-5-9-23(20)33-17-21/h2,4-5,8-9,16-17,19,22H,1,3,6-7,11-13,15,18,32H2,(H2,31,34,35)/t22-/m1/s1 |
| InChIKey | IUSSSPMVGJYDFI-JOCHJYFZSA-N |
| XLogP | 4.20 |
| TPSA | 115.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.63 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|