About N'-fluoro-N'-methylmethanediamine
N'-fluoro-N'-methylmethanediamine (PubChem CID 150625452) has the molecular formula C2H7FN2
and a molecular weight of 78.09 g/mol. Its IUPAC name is N'-fluoro-N'-methylmethanediamine.
Molecular Properties
| Compound Name | N'-fluoro-N'-methylmethanediamine |
| PubChem CID | 150625452 |
| Molecular Formula | C2H7FN2 |
| Molecular Weight | 78.09 g/mol |
| Exact Mass | 78.06 |
| IUPAC Name | N'-fluoro-N'-methylmethanediamine |
| SMILES | CN(F)CN |
| InChI | InChI=1S/C2H7FN2/c1-5(3)2-4/h2,4H2,1H3 |
| InChIKey | IWUCHFKAVLZIBD-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 78.09 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N'-fluoro-N'-methylmethanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-fluoro-N'-methylmethanediamine?
The IUPAC name of N'-fluoro-N'-methylmethanediamine (CID 150625452) is N'-fluoro-N'-methylmethanediamine.
What is the SMILES notation for N'-fluoro-N'-methylmethanediamine?
The canonical SMILES for N'-fluoro-N'-methylmethanediamine is CN(F)CN.
What is the InChIKey of N'-fluoro-N'-methylmethanediamine?
The InChIKey is IWUCHFKAVLZIBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H7FN2/c1-5(3)2-4/h2,4H2,1H3.
What are the key properties of N'-fluoro-N'-methylmethanediamine?
N'-fluoro-N'-methylmethanediamine has a molecular weight of 78.09 g/mol, XLogP of -0.28, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-fluoro-N'-methylmethanediamine is sourced from PubChem (CID 150625452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).