C2H6F2N2 — CID 71350299
1,1-difluoro-2,2-dimethylhydrazine (PubChem CID 71350299) has the molecular formula C2H6F2N2 and a molecular weight of 96.08 g/mol. Its IUPAC name is 1,1-difluoro-2,2-dimethylhydrazine.
| Compound Name | 1,1-difluoro-2,2-dimethylhydrazine |
|---|---|
| PubChem CID | 71350299 |
| Molecular Formula | C2H6F2N2 |
| Molecular Weight | 96.08 g/mol |
| Exact Mass | 96.05 |
| IUPAC Name | 1,1-difluoro-2,2-dimethylhydrazine |
| SMILES | CN(C)N(F)F |
| InChI | InChI=1S/C2H6F2N2/c1-5(2)6(3)4/h1-2H3 |
| InChIKey | XEAWMDAVSRHADC-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 96.08 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|