C16H12O4 — CID 150651054
2-(2,2-diphenylethenoxy)-2-oxoacetic acid (PubChem CID 150651054) has the molecular formula C16H12O4 and a molecular weight of 268.27 g/mol. Its IUPAC name is 2-(2,2-diphenylethenoxy)-2-oxoacetic acid.
| Compound Name | 2-(2,2-diphenylethenoxy)-2-oxoacetic acid |
|---|---|
| PubChem CID | 150651054 |
| Molecular Formula | C16H12O4 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 2-(2,2-diphenylethenoxy)-2-oxoacetic acid |
| SMILES | O=C(O)C(=O)OC=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H12O4/c17-15(18)16(19)20-11-14(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-11H,(H,17,18) |
| InChIKey | JBWRKWQHFZWHPJ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|