C12H19NO2 — CID 150665262
2,3-diethoxy-N,N-dimethylaniline (PubChem CID 150665262) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is 2,3-diethoxy-N,N-dimethylaniline.
| Compound Name | 2,3-diethoxy-N,N-dimethylaniline |
|---|---|
| PubChem CID | 150665262 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 2,3-diethoxy-N,N-dimethylaniline |
| SMILES | CCOc1cccc(N(C)C)c1OCC |
| InChI | InChI=1S/C12H19NO2/c1-5-14-11-9-7-8-10(13(3)4)12(11)15-6-2/h7-9H,5-6H2,1-4H3 |
| InChIKey | JESUCCZNEVQYPF-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |