C21H32O4Si2 — CID 173014982
(2,3-diethoxyphenyl)-[(2,3-diethoxyphenyl)silylmethyl]silane (PubChem CID 173014982) has the molecular formula C21H32O4Si2 and a molecular weight of 404.66 g/mol. Its IUPAC name is (2,3-diethoxyphenyl)-[(2,3-diethoxyphenyl)silylmethyl]silane.
| Compound Name | (2,3-diethoxyphenyl)-[(2,3-diethoxyphenyl)silylmethyl]silane |
|---|---|
| PubChem CID | 173014982 |
| Molecular Formula | C21H32O4Si2 |
| Molecular Weight | 404.66 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | (2,3-diethoxyphenyl)-[(2,3-diethoxyphenyl)silylmethyl]silane |
| SMILES | CCOc1cccc([SiH2]C[SiH2]c2cccc(OCC)c2OCC)c1OCC |
| InChI | InChI=1S/C21H32O4Si2/c1-5-22-16-11-9-13-18(20(16)24-7-3)26-15-27-19-14-10-12-17(23-6-2)21(19)25-8-4/h9-14H,5-8,15,26-27H2,1-4H3 |
| InChIKey | ZOLVIJBEFJURND-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.66 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|