C16H18BF4NO2 — CID 150673147
6-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(2,2,2-trifluoroethyl)indole (PubChem CID 150673147) has the molecular formula C16H18BF4NO2 and a molecular weight of 343.13 g/mol. Its IUPAC name is 6-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(2,2,2-trifluoroethyl)indole.
| Compound Name | 6-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(2,2,2-trifluoroethyl)indole |
|---|---|
| PubChem CID | 150673147 |
| Molecular Formula | C16H18BF4NO2 |
| Molecular Weight | 343.13 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 6-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(2,2,2-trifluoroethyl)indole |
| SMILES | CC1(C)OB(c2cc(F)cc3c2ccn3CC(F)(F)F)OC1(C)C |
| InChI | InChI=1S/C16H18BF4NO2/c1-14(2)15(3,4)24-17(23-14)12-7-10(18)8-13-11(12)5-6-22(13)9-16(19,20)21/h5-8H,9H2,1-4H3 |
| InChIKey | JGHILWPRCUHDLB-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.13 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|