C16H26OSi — CID 150692014
[(3E)-3-benzylidene-4,4-dimethylpentoxy]-dimethylsilane (PubChem CID 150692014) has the molecular formula C16H26OSi and a molecular weight of 262.47 g/mol. Its IUPAC name is [(3E)-3-benzylidene-4,4-dimethylpentoxy]-dimethylsilane.
| Compound Name | [(3E)-3-benzylidene-4,4-dimethylpentoxy]-dimethylsilane |
|---|---|
| PubChem CID | 150692014 |
| Molecular Formula | C16H26OSi |
| Molecular Weight | 262.47 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | [(3E)-3-benzylidene-4,4-dimethylpentoxy]-dimethylsilane |
| SMILES | C[SiH](C)OCC/C(=C\c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C16H26OSi/c1-16(2,3)15(11-12-17-18(4)5)13-14-9-7-6-8-10-14/h6-10,13,18H,11-12H2,1-5H3/b15-13+ |
| InChIKey | JKBQRJGXWIHLAD-FYWRMAATSA-N |
| XLogP | 4.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.47 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|