C34H28N4O6 — CID 150761596
9-carbamoyl-1,8-dicyano-10-(2-ethylhexylcarbamoyl)perylene-3,4-dicarboxylic acid (PubChem CID 150761596) has the molecular formula C34H28N4O6 and a molecular weight of 588.62 g/mol. Its IUPAC name is 9-carbamoyl-1,8-dicyano-10-(2-ethylhexylcarbamoyl)perylene-3,4-dicarboxylic acid.
| Compound Name | 9-carbamoyl-1,8-dicyano-10-(2-ethylhexylcarbamoyl)perylene-3,4-dicarboxylic acid |
|---|---|
| PubChem CID | 150761596 |
| Molecular Formula | C34H28N4O6 |
| Molecular Weight | 588.62 g/mol |
| Exact Mass | 588.20 |
| IUPAC Name | 9-carbamoyl-1,8-dicyano-10-(2-ethylhexylcarbamoyl)perylene-3,4-dicarboxylic acid |
| SMILES | CCCCC(CC)CNC(=O)c1ccc2c3c(C#N)cc(C(=O)O)c4c(C(=O)O)ccc(c5cc(C#N)c(C(N)=O)c1c52)c43 |
| InChI | InChI=1S/C34H28N4O6/c1-3-5-6-16(4-2)15-38-32(40)21-9-8-20-25-17(13-35)12-24(34(43)44)28-22(33(41)42)10-7-19(29(25)28)23-11-18(14-36)26(31(37)39)30(21)27(20)23/h7-12,16H,3-6,15H2,1-2H3,(H2,37,39)(H,38,40)(H,41,42)(H,43,44) |
| InChIKey | JXYIILBGLCLAKJ-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 194.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.62 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|