C32H28F2N2O6 — CID 151355599
9-carbamoyl-10-(2-ethylhexylcarbamoyl)-1,8-difluoroperylene-3,4-dicarboxylic acid (PubChem CID 151355599) has the molecular formula C32H28F2N2O6 and a molecular weight of 574.58 g/mol. Its IUPAC name is 9-carbamoyl-10-(2-ethylhexylcarbamoyl)-1,8-difluoroperylene-3,4-dicarboxylic acid.
| Compound Name | 9-carbamoyl-10-(2-ethylhexylcarbamoyl)-1,8-difluoroperylene-3,4-dicarboxylic acid |
|---|---|
| PubChem CID | 151355599 |
| Molecular Formula | C32H28F2N2O6 |
| Molecular Weight | 574.58 g/mol |
| Exact Mass | 574.19 |
| IUPAC Name | 9-carbamoyl-10-(2-ethylhexylcarbamoyl)-1,8-difluoroperylene-3,4-dicarboxylic acid |
| SMILES | CCCCC(CC)CNC(=O)c1ccc2c3c(F)cc(C(=O)O)c4c(C(=O)O)ccc(c5cc(F)c(C(N)=O)c1c52)c43 |
| InChI | InChI=1S/C32H28F2N2O6/c1-3-5-6-14(4-2)13-36-30(38)17-9-8-16-23-19(11-22(34)28(27(17)23)29(35)37)15-7-10-18(31(39)40)24-20(32(41)42)12-21(33)25(16)26(15)24/h7-12,14H,3-6,13H2,1-2H3,(H2,35,37)(H,36,38)(H,39,40)(H,41,42) |
| InChIKey | ONKFMCLHOBMGJE-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 146.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.58 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|