C24H29N3O6SSi — CID 150814395
3-O-benzyl 1-O-methyl 2-[amino-[1-(2-trimethylsilylethylsulfonyl)indazol-5-yl]methylidene]propanedioate (PubChem CID 150814395) has the molecular formula C24H29N3O6SSi and a molecular weight of 515.66 g/mol. Its IUPAC name is 3-O-benzyl 1-O-methyl 2-[amino-[1-(2-trimethylsilylethylsulfonyl)indazol-5-yl]methylidene]propanedioate.
| Compound Name | 3-O-benzyl 1-O-methyl 2-[amino-[1-(2-trimethylsilylethylsulfonyl)indazol-5-yl]methylidene]propanedioate |
|---|---|
| PubChem CID | 150814395 |
| Molecular Formula | C24H29N3O6SSi |
| Molecular Weight | 515.66 g/mol |
| Exact Mass | 515.15 |
| IUPAC Name | 3-O-benzyl 1-O-methyl 2-[amino-[1-(2-trimethylsilylethylsulfonyl)indazol-5-yl]methylidene]propanedioate |
| SMILES | COC(=O)C(C(=O)OCc1ccccc1)=C(N)c1ccc2c(cnn2S(=O)(=O)CC[Si](C)(C)C)c1 |
| InChI | InChI=1S/C24H29N3O6SSi/c1-32-23(28)21(24(29)33-16-17-8-6-5-7-9-17)22(25)18-10-11-20-19(14-18)15-26-27(20)34(30,31)12-13-35(2,3)4/h5-11,14-15H,12-13,16,25H2,1-4H3 |
| InChIKey | KIOFCZHQFMAOIU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 130.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.66 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|