C14H22NO4P — CID 150857541
[2-(2,2-dimethylpropanoylamino)phenyl]-propan-2-yloxyphosphinic acid (PubChem CID 150857541) has the molecular formula C14H22NO4P and a molecular weight of 299.31 g/mol. Its IUPAC name is [2-(2,2-dimethylpropanoylamino)phenyl]-propan-2-yloxyphosphinic acid.
| Compound Name | [2-(2,2-dimethylpropanoylamino)phenyl]-propan-2-yloxyphosphinic acid |
|---|---|
| PubChem CID | 150857541 |
| Molecular Formula | C14H22NO4P |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | [2-(2,2-dimethylpropanoylamino)phenyl]-propan-2-yloxyphosphinic acid |
| SMILES | CC(C)OP(=O)(O)c1ccccc1NC(=O)C(C)(C)C |
| InChI | InChI=1S/C14H22NO4P/c1-10(2)19-20(17,18)12-9-7-6-8-11(12)15-13(16)14(3,4)5/h6-10H,1-5H3,(H,15,16)(H,17,18) |
| InChIKey | KRHZQMHZLUTLFB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|