C58H114O6 — CID 150906387
(3R,4S,5R,6R)-3,4,5-tris(10,10-dimethylundecoxy)-6-(10,10-dimethylundecoxymethyl)oxan-2-one (PubChem CID 150906387) has the molecular formula C58H114O6 and a molecular weight of 907.54 g/mol. Its IUPAC name is (3R,4S,5R,6R)-3,4,5-tris(10,10-dimethylundecoxy)-6-(10,10-dimethylundecoxymethyl)oxan-2-one.
| Compound Name | (3R,4S,5R,6R)-3,4,5-tris(10,10-dimethylundecoxy)-6-(10,10-dimethylundecoxymethyl)oxan-2-one |
|---|---|
| PubChem CID | 150906387 |
| Molecular Formula | C58H114O6 |
| Molecular Weight | 907.54 g/mol |
| Exact Mass | 906.86 |
| IUPAC Name | (3R,4S,5R,6R)-3,4,5-tris(10,10-dimethylundecoxy)-6-(10,10-dimethylundecoxymethyl)oxan-2-one |
| SMILES | CC(C)(C)CCCCCCCCCOC[C@H]1OC(=O)[C@H](OCCCCCCCCCC(C)(C)C)[C@@H](OCCCCCCCCCC(C)(C)C)[C@@H]1OCCCCCCCCCC(C)(C)C |
| InChI | InChI=1S/C58H114O6/c1-55(2,3)41-33-25-17-13-21-29-37-45-60-49-50-51(61-46-38-30-22-14-18-26-34-42-56(4,5)6)52(62-47-39-31-23-15-19-27-35-43-57(7,8)9)53(54(59)64-50)63-48-40-32-24-16-20-28-36-44-58(10,11)12/h50-53H,13-49H2,1-12H3/t50-,51-,52+,53-/m1/s1 |
| InChIKey | LBBKOKRGISWTAE-GRIIBBEISA-N |
| XLogP | 17.75 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 907.54 |
| LogP ≤ 5 | 17.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|