C14H18O7 — CID 150926004
(E)-4-[3-(2-cyclopentylacetyl)oxy-3-oxopropoxy]-4-oxobut-2-enoic acid (PubChem CID 150926004) has the molecular formula C14H18O7 and a molecular weight of 298.29 g/mol. Its IUPAC name is (E)-4-[3-(2-cyclopentylacetyl)oxy-3-oxopropoxy]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[3-(2-cyclopentylacetyl)oxy-3-oxopropoxy]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 150926004 |
| Molecular Formula | C14H18O7 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | (E)-4-[3-(2-cyclopentylacetyl)oxy-3-oxopropoxy]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C=C/C(=O)OCCC(=O)OC(=O)CC1CCCC1 |
| InChI | InChI=1S/C14H18O7/c15-11(16)5-6-12(17)20-8-7-13(18)21-14(19)9-10-3-1-2-4-10/h5-6,10H,1-4,7-9H2,(H,15,16)/b6-5+ |
| InChIKey | LFAPZDSHJRUHJT-AATRIKPKSA-N |
| XLogP | 1.21 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|