C15H22O8 — CID 67733437
6-[2-[(E)-3-carboxyprop-2-enoyl]oxyethoxy]-6-oxohexanoic acid;cyclopropane (PubChem CID 67733437) has the molecular formula C15H22O8 and a molecular weight of 330.33 g/mol. Its IUPAC name is 6-[2-[(E)-3-carboxyprop-2-enoyl]oxyethoxy]-6-oxohexanoic acid;cyclopropane.
| Compound Name | 6-[2-[(E)-3-carboxyprop-2-enoyl]oxyethoxy]-6-oxohexanoic acid;cyclopropane |
|---|---|
| PubChem CID | 67733437 |
| Molecular Formula | C15H22O8 |
| Molecular Weight | 330.33 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 6-[2-[(E)-3-carboxyprop-2-enoyl]oxyethoxy]-6-oxohexanoic acid;cyclopropane |
| SMILES | C1CC1.O=C(O)/C=C/C(=O)OCCOC(=O)CCCCC(=O)O |
| InChI | InChI=1S/C12H16O8.C3H6/c13-9(14)3-1-2-4-11(17)19-7-8-20-12(18)6-5-10(15)16;1-2-3-1/h5-6H,1-4,7-8H2,(H,13,14)(H,15,16);1-3H2/b6-5+; |
| InChIKey | LUOYBFIAIGRSQV-IPZCTEOASA-N |
| XLogP | 1.53 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.33 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|