C29H25N5O5 — CID 150927868
N-[N-[[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]carbamoyl]-2-pyrrol-1-ylanilino]formamide (PubChem CID 150927868) has the molecular formula C29H25N5O5 and a molecular weight of 523.55 g/mol. Its IUPAC name is N-[N-[[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]carbamoyl]-2-pyrrol-1-ylanilino]formamide.
| Compound Name | N-[N-[[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]carbamoyl]-2-pyrrol-1-ylanilino]formamide |
|---|---|
| PubChem CID | 150927868 |
| Molecular Formula | C29H25N5O5 |
| Molecular Weight | 523.55 g/mol |
| Exact Mass | 523.19 |
| IUPAC Name | N-[N-[[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]carbamoyl]-2-pyrrol-1-ylanilino]formamide |
| SMILES | COc1cc2nccc(Oc3ccc(NC(=O)N(NC=O)c4ccccc4-n4cccc4)cc3)c2cc1OC |
| InChI | InChI=1S/C29H25N5O5/c1-37-27-17-22-23(18-28(27)38-2)30-14-13-26(22)39-21-11-9-20(10-12-21)32-29(36)34(31-19-35)25-8-4-3-7-24(25)33-15-5-6-16-33/h3-19H,1-2H3,(H,31,35)(H,32,36) |
| InChIKey | LFJYPKPSQAPFLU-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 106.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.55 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|