C23H21N5O6 — CID 151626650
N-[[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]carbamoyl-(5-methyl-1,2-oxazol-3-yl)amino]formamide (PubChem CID 151626650) has the molecular formula C23H21N5O6 and a molecular weight of 463.45 g/mol. Its IUPAC name is N-[[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]carbamoyl-(5-methyl-1,2-oxazol-3-yl)amino]formamide.
| Compound Name | N-[[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]carbamoyl-(5-methyl-1,2-oxazol-3-yl)amino]formamide |
|---|---|
| PubChem CID | 151626650 |
| Molecular Formula | C23H21N5O6 |
| Molecular Weight | 463.45 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | N-[[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]carbamoyl-(5-methyl-1,2-oxazol-3-yl)amino]formamide |
| SMILES | COc1cc2nccc(Oc3ccc(NC(=O)N(NC=O)c4cc(C)on4)cc3)c2cc1OC |
| InChI | InChI=1S/C23H21N5O6/c1-14-10-22(27-34-14)28(25-13-29)23(30)26-15-4-6-16(7-5-15)33-19-8-9-24-18-12-21(32-3)20(31-2)11-17(18)19/h4-13H,1-3H3,(H,25,29)(H,26,30) |
| InChIKey | QPQJGOSIDGSLAO-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 128.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.45 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|