C26H26Cl2N4O — CID 150951263
2-[(6R,7R,8S)-6-but-1-en-2-yl-6'-chloro-8-(3-chlorophenyl)spiro[8,9-dihydro-6H-pyrido[2,1-c][1,2,4]triazine-7,3'-indole]-2-yl]ethanol (PubChem CID 150951263) has the molecular formula C26H26Cl2N4O and a molecular weight of 481.43 g/mol. Its IUPAC name is 2-[(6R,7R,8S)-6-but-1-en-2-yl-6'-chloro-8-(3-chlorophenyl)spiro[8,9-dihydro-6H-pyrido[2,1-c][1,2,4]triazine-7,3'-indole]-2-yl]ethanol.
| Compound Name | 2-[(6R,7R,8S)-6-but-1-en-2-yl-6'-chloro-8-(3-chlorophenyl)spiro[8,9-dihydro-6H-pyrido[2,1-c][1,2,4]triazine-7,3'-indole]-2-yl]ethanol |
|---|---|
| PubChem CID | 150951263 |
| Molecular Formula | C26H26Cl2N4O |
| Molecular Weight | 481.43 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | 2-[(6R,7R,8S)-6-but-1-en-2-yl-6'-chloro-8-(3-chlorophenyl)spiro[8,9-dihydro-6H-pyrido[2,1-c][1,2,4]triazine-7,3'-indole]-2-yl]ethanol |
| SMILES | C=C(CC)[C@H]1N2C=CN(CCO)N=C2C[C@@H](c2cccc(Cl)c2)[C@]12C=Nc1cc(Cl)ccc12 |
| InChI | InChI=1S/C26H26Cl2N4O/c1-3-17(2)25-26(16-29-23-14-20(28)7-8-21(23)26)22(18-5-4-6-19(27)13-18)15-24-30-31(11-12-33)9-10-32(24)25/h4-10,13-14,16,22,25,33H,2-3,11-12,15H2,1H3/t22-,25+,26+/m0/s1 |
| InChIKey | LKDLVQFDFHXIIN-HDYLNDSGSA-N |
| XLogP | 5.86 |
| TPSA | 51.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.43 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|