C20H24ClFN2O6S — CID 150974734
(2R,3R)-1-[4-[(6-chloro-6-fluorocyclohexa-2,4-dien-1-yl)methoxy]phenyl]sulfonyl-N,3-dihydroxy-3-methylpiperidine-2-carboxamide (PubChem CID 150974734) has the molecular formula C20H24ClFN2O6S and a molecular weight of 474.94 g/mol. Its IUPAC name is (2R,3R)-1-[4-[(6-chloro-6-fluorocyclohexa-2,4-dien-1-yl)methoxy]phenyl]sulfonyl-N,3-dihydroxy-3-methylpiperidine-2-carboxamide.
| Compound Name | (2R,3R)-1-[4-[(6-chloro-6-fluorocyclohexa-2,4-dien-1-yl)methoxy]phenyl]sulfonyl-N,3-dihydroxy-3-methylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 150974734 |
| Molecular Formula | C20H24ClFN2O6S |
| Molecular Weight | 474.94 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | (2R,3R)-1-[4-[(6-chloro-6-fluorocyclohexa-2,4-dien-1-yl)methoxy]phenyl]sulfonyl-N,3-dihydroxy-3-methylpiperidine-2-carboxamide |
| SMILES | C[C@@]1(O)CCCN(S(=O)(=O)c2ccc(OCC3C=CC=CC3(F)Cl)cc2)[C@H]1C(=O)NO |
| InChI | InChI=1S/C20H24ClFN2O6S/c1-19(26)10-4-12-24(17(19)18(25)23-27)31(28,29)16-8-6-15(7-9-16)30-13-14-5-2-3-11-20(14,21)22/h2-3,5-9,11,14,17,26-27H,4,10,12-13H2,1H3,(H,23,25)/t14?,17-,19+,20?/m0/s1 |
| InChIKey | LOVYQHFMJVFCQL-LVGNYBRPSA-N |
| XLogP | 2.12 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.94 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|