C23H29F3O3 — CID 150976557
1-[4-(2,4,5-trifluorophenyl)phenyl]decoxymethanediol (PubChem CID 150976557) has the molecular formula C23H29F3O3 and a molecular weight of 410.48 g/mol. Its IUPAC name is 1-[4-(2,4,5-trifluorophenyl)phenyl]decoxymethanediol.
| Compound Name | 1-[4-(2,4,5-trifluorophenyl)phenyl]decoxymethanediol |
|---|---|
| PubChem CID | 150976557 |
| Molecular Formula | C23H29F3O3 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 1-[4-(2,4,5-trifluorophenyl)phenyl]decoxymethanediol |
| SMILES | CCCCCCCCCC(OC(O)O)c1ccc(-c2cc(F)c(F)cc2F)cc1 |
| InChI | InChI=1S/C23H29F3O3/c1-2-3-4-5-6-7-8-9-22(29-23(27)28)17-12-10-16(11-13-17)18-14-20(25)21(26)15-19(18)24/h10-15,22-23,27-28H,2-9H2,1H3 |
| InChIKey | LPFHJNBROUVMDU-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|