C28H30N2Si — CID 150998873
7,7-dimethyl-5-N-(4-trimethylsilylphenyl)benzo[c]fluorene-5,9-diamine (PubChem CID 150998873) has the molecular formula C28H30N2Si and a molecular weight of 422.65 g/mol. Its IUPAC name is 7,7-dimethyl-5-N-(4-trimethylsilylphenyl)benzo[c]fluorene-5,9-diamine.
| Compound Name | 7,7-dimethyl-5-N-(4-trimethylsilylphenyl)benzo[c]fluorene-5,9-diamine |
|---|---|
| PubChem CID | 150998873 |
| Molecular Formula | C28H30N2Si |
| Molecular Weight | 422.65 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | 7,7-dimethyl-5-N-(4-trimethylsilylphenyl)benzo[c]fluorene-5,9-diamine |
| SMILES | CC1(C)c2cc(N)ccc2-c2c1cc(Nc1ccc([Si](C)(C)C)cc1)c1ccccc21 |
| InChI | InChI=1S/C28H30N2Si/c1-28(2)24-16-18(29)10-15-23(24)27-22-9-7-6-8-21(22)26(17-25(27)28)30-19-11-13-20(14-12-19)31(3,4)5/h6-17,30H,29H2,1-5H3 |
| InChIKey | LTRLAGMTJRXMNP-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.65 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|