C23H23ClNOP — CID 15099948
1-[[chloro(triphenyl)-lambda5-phosphanyl]methyl]pyrrolidin-2-one (PubChem CID 15099948) has the molecular formula C23H23ClNOP and a molecular weight of 395.87 g/mol. Its IUPAC name is 1-[[chloro(triphenyl)-lambda5-phosphanyl]methyl]pyrrolidin-2-one.
| Compound Name | 1-[[chloro(triphenyl)-lambda5-phosphanyl]methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 15099948 |
| Molecular Formula | C23H23ClNOP |
| Molecular Weight | 395.87 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 1-[[chloro(triphenyl)-lambda5-phosphanyl]methyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1CP(Cl)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H23ClNOP/c24-27(20-11-4-1-5-12-20,21-13-6-2-7-14-21,22-15-8-3-9-16-22)19-25-18-10-17-23(25)26/h1-9,11-16H,10,17-19H2 |
| InChIKey | LGXFBMONQOKJLA-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.87 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|