C32H38O7S — CID 151037564
1-[(2R,3R,4S,5R,6S)-6-(2,3-dihydroxypropoxy)-3,4,5-tris(phenylmethoxy)oxan-2-yl]propane-2-thione (PubChem CID 151037564) has the molecular formula C32H38O7S and a molecular weight of 566.72 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R,6S)-6-(2,3-dihydroxypropoxy)-3,4,5-tris(phenylmethoxy)oxan-2-yl]propane-2-thione.
| Compound Name | 1-[(2R,3R,4S,5R,6S)-6-(2,3-dihydroxypropoxy)-3,4,5-tris(phenylmethoxy)oxan-2-yl]propane-2-thione |
|---|---|
| PubChem CID | 151037564 |
| Molecular Formula | C32H38O7S |
| Molecular Weight | 566.72 g/mol |
| Exact Mass | 566.23 |
| IUPAC Name | 1-[(2R,3R,4S,5R,6S)-6-(2,3-dihydroxypropoxy)-3,4,5-tris(phenylmethoxy)oxan-2-yl]propane-2-thione |
| SMILES | CC(=S)C[C@H]1O[C@H](OCC(O)CO)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C32H38O7S/c1-23(40)17-28-29(35-19-24-11-5-2-6-12-24)30(36-20-25-13-7-3-8-14-25)31(32(39-28)38-22-27(34)18-33)37-21-26-15-9-4-10-16-26/h2-16,27-34H,17-22H2,1H3/t27?,28-,29-,30+,31-,32+/m1/s1 |
| InChIKey | MBJVAUVLQMKRRW-PCBMCYHXSA-N |
| XLogP | 4.62 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.72 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|