About 7-methoxy-5-methyl-3,4-dihydro-2H-pyrimido[1,6-a]indol-1-one
7-methoxy-5-methyl-3,4-dihydro-2H-pyrimido[1,6-a]indol-1-one (PubChem CID 15112644) has the molecular formula C13H14N2O2
and a molecular weight of 230.27 g/mol. Its IUPAC name is 7-methoxy-5-methyl-3,4-dihydro-2H-pyrimido[1,6-a]indol-1-one.
Molecular Properties
| Compound Name | 7-methoxy-5-methyl-3,4-dihydro-2H-pyrimido[1,6-a]indol-1-one |
| PubChem CID | 15112644 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 7-methoxy-5-methyl-3,4-dihydro-2H-pyrimido[1,6-a]indol-1-one |
| SMILES | COc1ccc2c(c1)c(C)c1n2C(=O)NCC1 |
| InChI | InChI=1S/C13H14N2O2/c1-8-10-7-9(17-2)3-4-12(10)15-11(8)5-6-14-13(15)16/h3-4,7H,5-6H2,1-2H3,(H,14,16) |
| InChIKey | QDMGRGBTCYIYGQ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-methoxy-5-methyl-3,4-dihydro-2H-pyrimido[1,6-a]indol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxy-5-methyl-3,4-dihydro-2H-pyrimido[1,6-a]indol-1-one?
The IUPAC name of 7-methoxy-5-methyl-3,4-dihydro-2H-pyrimido[1,6-a]indol-1-one (CID 15112644) is 7-methoxy-5-methyl-3,4-dihydro-2H-pyrimido[1,6-a]indol-1-one.
What is the SMILES notation for 7-methoxy-5-methyl-3,4-dihydro-2H-pyrimido[1,6-a]indol-1-one?
The canonical SMILES for 7-methoxy-5-methyl-3,4-dihydro-2H-pyrimido[1,6-a]indol-1-one is COc1ccc2c(c1)c(C)c1n2C(=O)NCC1.
What is the InChIKey of 7-methoxy-5-methyl-3,4-dihydro-2H-pyrimido[1,6-a]indol-1-one?
The InChIKey is QDMGRGBTCYIYGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O2/c1-8-10-7-9(17-2)3-4-12(10)15-11(8)5-6-14-13(15)16/h3-4,7H,5-6H2,1-2H3,(H,14,16).
What are the key properties of 7-methoxy-5-methyl-3,4-dihydro-2H-pyrimido[1,6-a]indol-1-one?
7-methoxy-5-methyl-3,4-dihydro-2H-pyrimido[1,6-a]indol-1-one has a molecular weight of 230.27 g/mol, XLogP of 2.07, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxy-5-methyl-3,4-dihydro-2H-pyrimido[1,6-a]indol-1-one is sourced from PubChem (CID 15112644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).