C10H10N2O4 — CID 151180490
1-acetyl-5-nitro-3a,4-dihydro-3H-indol-2-one (PubChem CID 151180490) has the molecular formula C10H10N2O4 and a molecular weight of 222.20 g/mol. Its IUPAC name is 1-acetyl-5-nitro-3a,4-dihydro-3H-indol-2-one.
| Compound Name | 1-acetyl-5-nitro-3a,4-dihydro-3H-indol-2-one |
|---|---|
| PubChem CID | 151180490 |
| Molecular Formula | C10H10N2O4 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 1-acetyl-5-nitro-3a,4-dihydro-3H-indol-2-one |
| SMILES | CC(=O)N1C(=O)CC2CC([N+](=O)[O-])=CC=C21 |
| InChI | InChI=1S/C10H10N2O4/c1-6(13)11-9-3-2-8(12(15)16)4-7(9)5-10(11)14/h2-3,7H,4-5H2,1H3 |
| InChIKey | NEENJRPSMCAYSB-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|