C31H38O2Si3 — CID 151212547
[diphenyl-(2,3,4-trimethylphenyl)silyl]oxy-methyl-phenyl-trimethylsilyloxysilane (PubChem CID 151212547) has the molecular formula C31H38O2Si3 and a molecular weight of 526.90 g/mol. Its IUPAC name is [diphenyl-(2,3,4-trimethylphenyl)silyl]oxy-methyl-phenyl-trimethylsilyloxysilane.
| Compound Name | [diphenyl-(2,3,4-trimethylphenyl)silyl]oxy-methyl-phenyl-trimethylsilyloxysilane |
|---|---|
| PubChem CID | 151212547 |
| Molecular Formula | C31H38O2Si3 |
| Molecular Weight | 526.90 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | [diphenyl-(2,3,4-trimethylphenyl)silyl]oxy-methyl-phenyl-trimethylsilyloxysilane |
| SMILES | Cc1ccc([Si](O[Si](C)(O[Si](C)(C)C)c2ccccc2)(c2ccccc2)c2ccccc2)c(C)c1C |
| InChI | InChI=1S/C31H38O2Si3/c1-25-23-24-31(27(3)26(25)2)36(29-19-13-9-14-20-29,30-21-15-10-16-22-30)33-35(7,32-34(4,5)6)28-17-11-8-12-18-28/h8-24H,1-7H3 |
| InChIKey | NKORRDNRDPUZHC-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.90 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|