C25H29NO6 — CID 151225203
1-[2-(3-cycloheptyloxy-3-oxoprop-1-enyl)phenyl]-2,6-dimethyl-4H-pyridine-3,5-dicarboxylic acid (PubChem CID 151225203) has the molecular formula C25H29NO6 and a molecular weight of 439.51 g/mol. Its IUPAC name is 1-[2-(3-cycloheptyloxy-3-oxoprop-1-enyl)phenyl]-2,6-dimethyl-4H-pyridine-3,5-dicarboxylic acid.
| Compound Name | 1-[2-(3-cycloheptyloxy-3-oxoprop-1-enyl)phenyl]-2,6-dimethyl-4H-pyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 151225203 |
| Molecular Formula | C25H29NO6 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | 1-[2-(3-cycloheptyloxy-3-oxoprop-1-enyl)phenyl]-2,6-dimethyl-4H-pyridine-3,5-dicarboxylic acid |
| SMILES | CC1=C(C(=O)O)CC(C(=O)O)=C(C)N1c1ccccc1C=CC(=O)OC1CCCCCC1 |
| InChI | InChI=1S/C25H29NO6/c1-16-20(24(28)29)15-21(25(30)31)17(2)26(16)22-12-8-7-9-18(22)13-14-23(27)32-19-10-5-3-4-6-11-19/h7-9,12-14,19H,3-6,10-11,15H2,1-2H3,(H,28,29)(H,30,31) |
| InChIKey | NNCTUNXYEVCJEQ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|