C19H16FN3 — CID 151231214
6-[[2-(4-fluorophenyl)-5-methylpyrrol-1-yl]methyl]-1H-indazole (PubChem CID 151231214) has the molecular formula C19H16FN3 and a molecular weight of 305.36 g/mol. Its IUPAC name is 6-[[2-(4-fluorophenyl)-5-methylpyrrol-1-yl]methyl]-1H-indazole.
| Compound Name | 6-[[2-(4-fluorophenyl)-5-methylpyrrol-1-yl]methyl]-1H-indazole |
|---|---|
| PubChem CID | 151231214 |
| Molecular Formula | C19H16FN3 |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 6-[[2-(4-fluorophenyl)-5-methylpyrrol-1-yl]methyl]-1H-indazole |
| SMILES | Cc1ccc(-c2ccc(F)cc2)n1Cc1ccc2cn[nH]c2c1 |
| InChI | InChI=1S/C19H16FN3/c1-13-2-9-19(15-5-7-17(20)8-6-15)23(13)12-14-3-4-16-11-21-22-18(16)10-14/h2-11H,12H2,1H3,(H,21,22) |
| InChIKey | NOIDYWMNMUQETB-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_C(8)', 'substructure': 'N/A'} |
|---|