C28H24O5S — CID 151282495
1-(4-hydroxyphenyl)-3-(4-propoxyphenyl)-9H-fluorene-2-sulfonic acid (PubChem CID 151282495) has the molecular formula C28H24O5S and a molecular weight of 472.56 g/mol. Its IUPAC name is 1-(4-hydroxyphenyl)-3-(4-propoxyphenyl)-9H-fluorene-2-sulfonic acid.
| Compound Name | 1-(4-hydroxyphenyl)-3-(4-propoxyphenyl)-9H-fluorene-2-sulfonic acid |
|---|---|
| PubChem CID | 151282495 |
| Molecular Formula | C28H24O5S |
| Molecular Weight | 472.56 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | 1-(4-hydroxyphenyl)-3-(4-propoxyphenyl)-9H-fluorene-2-sulfonic acid |
| SMILES | CCCOc1ccc(-c2cc3c(c(-c4ccc(O)cc4)c2S(=O)(=O)O)Cc2ccccc2-3)cc1 |
| InChI | InChI=1S/C28H24O5S/c1-2-15-33-22-13-9-18(10-14-22)24-17-25-23-6-4-3-5-20(23)16-26(25)27(28(24)34(30,31)32)19-7-11-21(29)12-8-19/h3-14,17,29H,2,15-16H2,1H3,(H,30,31,32) |
| InChIKey | NYRVNSVDXANLHM-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.56 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|