C4H9NS2 — CID 151347438
(2R,5R)-pyrrolidine-2,5-dithiol (PubChem CID 151347438) has the molecular formula C4H9NS2 and a molecular weight of 135.26 g/mol. Its IUPAC name is (2R,5R)-pyrrolidine-2,5-dithiol.
| Compound Name | (2R,5R)-pyrrolidine-2,5-dithiol |
|---|---|
| PubChem CID | 151347438 |
| Molecular Formula | C4H9NS2 |
| Molecular Weight | 135.26 g/mol |
| Exact Mass | 135.02 |
| IUPAC Name | (2R,5R)-pyrrolidine-2,5-dithiol |
| SMILES | S[C@@H]1CC[C@@H](S)N1 |
| InChI | InChI=1S/C4H9NS2/c6-3-1-2-4(7)5-3/h3-7H,1-2H2/t3-,4-/m1/s1 |
| InChIKey | OLTRTPPSWNNHPN-QWWZWVQMSA-N |
| XLogP | 0.88 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.26 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|