C48H69N3O6 — CID 15140003
4-[[4,6-Bis[(3,5-ditert-butyl-4-hydroxyphenyl)methoxy]-1,3,5-triazin-2-yl]oxymethyl]-2,6-ditert-butylphenol (PubChem CID 15140003) has the molecular formula C48H69N3O6 and a molecular weight of 784.10 g/mol. Its IUPAC name is 4-[[4,6-bis[(3,5-ditert-butyl-4-hydroxyphenyl)methoxy]-1,3,5-triazin-2-yl]oxymethyl]-2,6-ditert-butylphenol.
| Compound Name | 4-[[4,6-Bis[(3,5-ditert-butyl-4-hydroxyphenyl)methoxy]-1,3,5-triazin-2-yl]oxymethyl]-2,6-ditert-butylphenol |
|---|---|
| PubChem CID | 15140003 |
| Molecular Formula | C48H69N3O6 |
| Molecular Weight | 784.10 g/mol |
| Exact Mass | 783.52 |
| IUPAC Name | 4-[[4,6-bis[(3,5-ditert-butyl-4-hydroxyphenyl)methoxy]-1,3,5-triazin-2-yl]oxymethyl]-2,6-ditert-butylphenol |
| SMILES | CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)COC2=NC(=NC(=N2)OCC3=CC(=C(C(=C3)C(C)(C)C)O)C(C)(C)C)OCC4=CC(=C(C(=C4)C(C)(C)C)O)C(C)(C)C |
| InChI | InChI=1S/C48H69N3O6/c1-43(2,3)31-19-28(20-32(37(31)52)44(4,5)6)25-55-40-49-41(56-26-29-21-33(45(7,8)9)38(53)34(22-29)46(10,11)12)51-42(50-40)57-27-30-23-35(47(13,14)15)39(54)36(24-30)48(16,17)18/h19-24,52-54H,25-27H2,1-18H3 |
| InChIKey | RLPDTLIWXFZHTL-UHFFFAOYSA-N |
| XLogP | 14.30 |
| TPSA | 127.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 57 |
| Complexity | 1020 |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.10 |
| LogP ≤ 5 | 14.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |