C42H57N3O6 — CID 19934089
3-[[4,6-bis[(4-tert-butyl-3-hydroxy-2,6-dimethylphenyl)methoxy]-1,3,5-triazin-2-yl]oxymethyl]-6-tert-butyl-2,4-dimethylphenol (PubChem CID 19934089) has the molecular formula C42H57N3O6 and a molecular weight of 699.93 g/mol. Its IUPAC name is 3-[[4,6-bis[(4-tert-butyl-3-hydroxy-2,6-dimethylphenyl)methoxy]-1,3,5-triazin-2-yl]oxymethyl]-6-tert-butyl-2,4-dimethylphenol.
| Compound Name | 3-[[4,6-bis[(4-tert-butyl-3-hydroxy-2,6-dimethylphenyl)methoxy]-1,3,5-triazin-2-yl]oxymethyl]-6-tert-butyl-2,4-dimethylphenol |
|---|---|
| PubChem CID | 19934089 |
| Molecular Formula | C42H57N3O6 |
| Molecular Weight | 699.93 g/mol |
| Exact Mass | 699.42 |
| IUPAC Name | 3-[[4,6-bis[(4-tert-butyl-3-hydroxy-2,6-dimethylphenyl)methoxy]-1,3,5-triazin-2-yl]oxymethyl]-6-tert-butyl-2,4-dimethylphenol |
| SMILES | Cc1cc(C(C)(C)C)c(O)c(C)c1COc1nc(OCc2c(C)cc(C(C)(C)C)c(O)c2C)nc(OCc2c(C)cc(C(C)(C)C)c(O)c2C)n1 |
| InChI | InChI=1S/C42H57N3O6/c1-22-16-31(40(7,8)9)34(46)25(4)28(22)19-49-37-43-38(50-20-29-23(2)17-32(41(10,11)12)35(47)26(29)5)45-39(44-37)51-21-30-24(3)18-33(42(13,14)15)36(48)27(30)6/h16-18,46-48H,19-21H2,1-15H3 |
| InChIKey | SHSMWWDYPRPYRY-UHFFFAOYSA-N |
| XLogP | 9.47 |
| TPSA | 127.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.93 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |