C18H27F3N4O2 — CID 151434816
(2S)-6-amino-2-[[3-[[3-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]amino]hexanoic acid (PubChem CID 151434816) has the molecular formula C18H27F3N4O2 and a molecular weight of 388.43 g/mol. Its IUPAC name is (2S)-6-amino-2-[[3-[[3-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[3-[[3-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]amino]hexanoic acid |
|---|---|
| PubChem CID | 151434816 |
| Molecular Formula | C18H27F3N4O2 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | (2S)-6-amino-2-[[3-[[3-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]amino]hexanoic acid |
| SMILES | NCCCC[C@H](NN1CCNC(Cc2cccc(C(F)(F)F)c2)C1)C(=O)O |
| InChI | InChI=1S/C18H27F3N4O2/c19-18(20,21)14-5-3-4-13(10-14)11-15-12-25(9-8-23-15)24-16(17(26)27)6-1-2-7-22/h3-5,10,15-16,23-24H,1-2,6-9,11-12,22H2,(H,26,27)/t15?,16-/m0/s1 |
| InChIKey | PDGSNDFQQAEANE-LYKKTTPLSA-N |
| XLogP | 1.61 |
| TPSA | 90.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|