C11H12IN5O3 — CID 151442557
1-(4-amino-3-iodopyrazolo[3,4-d]pyrimidin-1-yl)-3-(hydroxymethyl)cyclopent-3-ene-1,2-diol (PubChem CID 151442557) has the molecular formula C11H12IN5O3 and a molecular weight of 389.15 g/mol. Its IUPAC name is 1-(4-amino-3-iodopyrazolo[3,4-d]pyrimidin-1-yl)-3-(hydroxymethyl)cyclopent-3-ene-1,2-diol.
| Compound Name | 1-(4-amino-3-iodopyrazolo[3,4-d]pyrimidin-1-yl)-3-(hydroxymethyl)cyclopent-3-ene-1,2-diol |
|---|---|
| PubChem CID | 151442557 |
| Molecular Formula | C11H12IN5O3 |
| Molecular Weight | 389.15 g/mol |
| Exact Mass | 389.00 |
| IUPAC Name | 1-(4-amino-3-iodopyrazolo[3,4-d]pyrimidin-1-yl)-3-(hydroxymethyl)cyclopent-3-ene-1,2-diol |
| SMILES | Nc1ncnc2c1c(I)nn2C1(O)CC=C(CO)C1O |
| InChI | InChI=1S/C11H12IN5O3/c12-8-6-9(13)14-4-15-10(6)17(16-8)11(20)2-1-5(3-18)7(11)19/h1,4,7,18-20H,2-3H2,(H2,13,14,15) |
| InChIKey | PEUZSUKCBWEZAH-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 130.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.15 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|