C16H21NO6S — CID 15153688
1-[2-hydroxy-2-methyl-5-(4-methylphenyl)sulfonyl-5-nitrocyclohexyl]ethanone (PubChem CID 15153688) has the molecular formula C16H21NO6S and a molecular weight of 355.41 g/mol. Its IUPAC name is 1-[2-hydroxy-2-methyl-5-(4-methylphenyl)sulfonyl-5-nitrocyclohexyl]ethanone.
| Compound Name | 1-[2-hydroxy-2-methyl-5-(4-methylphenyl)sulfonyl-5-nitrocyclohexyl]ethanone |
|---|---|
| PubChem CID | 15153688 |
| Molecular Formula | C16H21NO6S |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 1-[2-hydroxy-2-methyl-5-(4-methylphenyl)sulfonyl-5-nitrocyclohexyl]ethanone |
| SMILES | CC(=O)C1CC([N+](=O)[O-])(S(=O)(=O)c2ccc(C)cc2)CCC1(C)O |
| InChI | InChI=1S/C16H21NO6S/c1-11-4-6-13(7-5-11)24(22,23)16(17(20)21)9-8-15(3,19)14(10-16)12(2)18/h4-7,14,19H,8-10H2,1-3H3 |
| InChIKey | SCEBODNEVIPVSI-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 114.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|