C16H24O6 — CID 151598801
2-[4-hydroxy-2-(2-methylprop-2-enoxy)butoxy]carbonylcyclohex-3-ene-1-carboxylic acid (PubChem CID 151598801) has the molecular formula C16H24O6 and a molecular weight of 312.36 g/mol. Its IUPAC name is 2-[4-hydroxy-2-(2-methylprop-2-enoxy)butoxy]carbonylcyclohex-3-ene-1-carboxylic acid.
| Compound Name | 2-[4-hydroxy-2-(2-methylprop-2-enoxy)butoxy]carbonylcyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 151598801 |
| Molecular Formula | C16H24O6 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 2-[4-hydroxy-2-(2-methylprop-2-enoxy)butoxy]carbonylcyclohex-3-ene-1-carboxylic acid |
| SMILES | C=C(C)COC(CCO)COC(=O)C1C=CCCC1C(=O)O |
| InChI | InChI=1S/C16H24O6/c1-11(2)9-21-12(7-8-17)10-22-16(20)14-6-4-3-5-13(14)15(18)19/h4,6,12-14,17H,1,3,5,7-10H2,2H3,(H,18,19) |
| InChIKey | QKASYYTWCPLDDP-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|