C15H14BrClF6O4 — CID 151612677
4-[(2-bromo-1,1,2,2-tetrafluoroethoxy)methyl]-4-[2-chloro-4-(difluoromethoxy)phenyl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 151612677) has the molecular formula C15H14BrClF6O4 and a molecular weight of 487.62 g/mol. Its IUPAC name is 4-[(2-bromo-1,1,2,2-tetrafluoroethoxy)methyl]-4-[2-chloro-4-(difluoromethoxy)phenyl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | 4-[(2-bromo-1,1,2,2-tetrafluoroethoxy)methyl]-4-[2-chloro-4-(difluoromethoxy)phenyl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 151612677 |
| Molecular Formula | C15H14BrClF6O4 |
| Molecular Weight | 487.62 g/mol |
| Exact Mass | 485.97 |
| IUPAC Name | 4-[(2-bromo-1,1,2,2-tetrafluoroethoxy)methyl]-4-[2-chloro-4-(difluoromethoxy)phenyl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | CC1(C)OCC(COC(F)(F)C(F)(F)Br)(c2ccc(OC(F)F)cc2Cl)O1 |
| InChI | InChI=1S/C15H14BrClF6O4/c1-12(2)24-6-13(27-12,7-25-15(22,23)14(16,20)21)9-4-3-8(5-10(9)17)26-11(18)19/h3-5,11H,6-7H2,1-2H3 |
| InChIKey | QMVNBHYLBYLGIC-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.62 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|