C12H16N2O4 — CID 15162554
3-ethyl-2-(4-nitrophenyl)-3-oxido-1,3-oxazinan-3-ium (PubChem CID 15162554) has the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. Its IUPAC name is 3-ethyl-2-(4-nitrophenyl)-3-oxido-1,3-oxazinan-3-ium.
| Compound Name | 3-ethyl-2-(4-nitrophenyl)-3-oxido-1,3-oxazinan-3-ium |
|---|---|
| PubChem CID | 15162554 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 3-ethyl-2-(4-nitrophenyl)-3-oxido-1,3-oxazinan-3-ium |
| SMILES | CC[N+]1([O-])CCCOC1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H16N2O4/c1-2-14(17)8-3-9-18-12(14)10-4-6-11(7-5-10)13(15)16/h4-7,12H,2-3,8-9H2,1H3 |
| InChIKey | DLMCQNAFVIEPJH-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 75.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|