C24H31ClN2O5S — CID 151643009
5-O-tert-butyl 3-O-ethyl 4-(3-chlorophenyl)-2-(2-formamidoethylsulfanyl)-1,6-dimethyl-4H-pyridine-3,5-dicarboxylate (PubChem CID 151643009) has the molecular formula C24H31ClN2O5S and a molecular weight of 495.04 g/mol. Its IUPAC name is 5-O-tert-butyl 3-O-ethyl 4-(3-chlorophenyl)-2-(2-formamidoethylsulfanyl)-1,6-dimethyl-4H-pyridine-3,5-dicarboxylate.
| Compound Name | 5-O-tert-butyl 3-O-ethyl 4-(3-chlorophenyl)-2-(2-formamidoethylsulfanyl)-1,6-dimethyl-4H-pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 151643009 |
| Molecular Formula | C24H31ClN2O5S |
| Molecular Weight | 495.04 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | 5-O-tert-butyl 3-O-ethyl 4-(3-chlorophenyl)-2-(2-formamidoethylsulfanyl)-1,6-dimethyl-4H-pyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(SCCNC=O)N(C)C(C)=C(C(=O)OC(C)(C)C)C1c1cccc(Cl)c1 |
| InChI | InChI=1S/C24H31ClN2O5S/c1-7-31-22(29)20-19(16-9-8-10-17(25)13-16)18(23(30)32-24(3,4)5)15(2)27(6)21(20)33-12-11-26-14-28/h8-10,13-14,19H,7,11-12H2,1-6H3,(H,26,28) |
| InChIKey | QSXVAKJUQDYCGV-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.04 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|