C22H27Cl2N3O6S — CID 67867621
[amino-[[4-(3-chlorophenyl)-3,5,6-tris(ethoxycarbonyl)-1,4-dihydropyridin-2-yl]methylsulfanyl]methylidene]azanium chloride (PubChem CID 67867621) has the molecular formula C22H27Cl2N3O6S and a molecular weight of 532.45 g/mol. Its IUPAC name is [amino-[[4-(3-chlorophenyl)-3,5,6-tris(ethoxycarbonyl)-1,4-dihydropyridin-2-yl]methylsulfanyl]methylidene]azanium chloride.
| Compound Name | [amino-[[4-(3-chlorophenyl)-3,5,6-tris(ethoxycarbonyl)-1,4-dihydropyridin-2-yl]methylsulfanyl]methylidene]azanium chloride |
|---|---|
| PubChem CID | 67867621 |
| Molecular Formula | C22H27Cl2N3O6S |
| Molecular Weight | 532.45 g/mol |
| Exact Mass | 531.10 |
| IUPAC Name | [amino-[[4-(3-chlorophenyl)-3,5,6-tris(ethoxycarbonyl)-1,4-dihydropyridin-2-yl]methylsulfanyl]methylidene]azanium chloride |
| SMILES | CCOC(=O)C1=C(C(=O)OCC)C(c2cccc(Cl)c2)C(C(=O)OCC)=C(CSC(N)=[NH2+])N1.[Cl-] |
| InChI | InChI=1S/C22H26ClN3O6S.ClH/c1-4-30-19(27)16-14(11-33-22(24)25)26-18(21(29)32-6-3)17(20(28)31-5-2)15(16)12-8-7-9-13(23)10-12;/h7-10,15,26H,4-6,11H2,1-3H3,(H3,24,25);1H |
| InChIKey | DAXWGDBQBCKZNM-UHFFFAOYSA-N |
| XLogP | -1.96 |
| TPSA | 142.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.45 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|