C7H5Cl2F2NS — CID 151650297
2,6-dichloro-4-(difluoromethylsulfanyl)aniline (PubChem CID 151650297) has the molecular formula C7H5Cl2F2NS and a molecular weight of 244.09 g/mol. Its IUPAC name is 2,6-dichloro-4-(difluoromethylsulfanyl)aniline.
| Compound Name | 2,6-dichloro-4-(difluoromethylsulfanyl)aniline |
|---|---|
| PubChem CID | 151650297 |
| Molecular Formula | C7H5Cl2F2NS |
| Molecular Weight | 244.09 g/mol |
| Exact Mass | 242.95 |
| IUPAC Name | 2,6-dichloro-4-(difluoromethylsulfanyl)aniline |
| SMILES | Nc1c(Cl)cc(SC(F)F)cc1Cl |
| InChI | InChI=1S/C7H5Cl2F2NS/c8-4-1-3(13-7(10)11)2-5(9)6(4)12/h1-2,7H,12H2 |
| InChIKey | QUJKTVMTHQOEEJ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.09 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|