C27H43NO2 — CID 151678813
N-(1-hydroxy-2-propylheptyl)heptadeca-2,4,6,10,12,14-hexaenamide (PubChem CID 151678813) has the molecular formula C27H43NO2 and a molecular weight of 413.65 g/mol. Its IUPAC name is N-(1-hydroxy-2-propylheptyl)heptadeca-2,4,6,10,12,14-hexaenamide.
| Compound Name | N-(1-hydroxy-2-propylheptyl)heptadeca-2,4,6,10,12,14-hexaenamide |
|---|---|
| PubChem CID | 151678813 |
| Molecular Formula | C27H43NO2 |
| Molecular Weight | 413.65 g/mol |
| Exact Mass | 413.33 |
| IUPAC Name | N-(1-hydroxy-2-propylheptyl)heptadeca-2,4,6,10,12,14-hexaenamide |
| SMILES | CCC=CC=CC=CCCC=CC=CC=CC(=O)NC(O)C(CCC)CCCCC |
| InChI | InChI=1S/C27H43NO2/c1-4-7-9-10-11-12-13-14-15-16-17-18-19-21-24-26(29)28-27(30)25(22-6-3)23-20-8-5-2/h7,9-13,16-19,21,24-25,27,30H,4-6,8,14-15,20,22-23H2,1-3H3,(H,28,29) |
| InChIKey | RACAFQQKAMBIAP-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.65 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|