C16H27NO2 — CID 118682788
N-[5-(hydroxymethyl)-7-methyloctyl]cyclopenta-1,3-diene-1-carboxamide (PubChem CID 118682788) has the molecular formula C16H27NO2 and a molecular weight of 265.40 g/mol. Its IUPAC name is N-[5-(hydroxymethyl)-7-methyloctyl]cyclopenta-1,3-diene-1-carboxamide.
| Compound Name | N-[5-(hydroxymethyl)-7-methyloctyl]cyclopenta-1,3-diene-1-carboxamide |
|---|---|
| PubChem CID | 118682788 |
| Molecular Formula | C16H27NO2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | N-[5-(hydroxymethyl)-7-methyloctyl]cyclopenta-1,3-diene-1-carboxamide |
| SMILES | CC(C)CC(CO)CCCCNC(=O)C1=CC=CC1 |
| InChI | InChI=1S/C16H27NO2/c1-13(2)11-14(12-18)7-5-6-10-17-16(19)15-8-3-4-9-15/h3-4,8,13-14,18H,5-7,9-12H2,1-2H3,(H,17,19) |
| InChIKey | FTOYGZXXCKLARL-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|