C17H16N2O3 — CID 15171556
3-[[2-(ethylamino)-1,3-benzoxazol-5-yl]methoxy]benzaldehyde (PubChem CID 15171556) has the molecular formula C17H16N2O3 and a molecular weight of 296.33 g/mol. Its IUPAC name is 3-[[2-(ethylamino)-1,3-benzoxazol-5-yl]methoxy]benzaldehyde.
| Compound Name | 3-[[2-(ethylamino)-1,3-benzoxazol-5-yl]methoxy]benzaldehyde |
|---|---|
| PubChem CID | 15171556 |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 3-[[2-(ethylamino)-1,3-benzoxazol-5-yl]methoxy]benzaldehyde |
| SMILES | CCNc1nc2cc(COc3cccc(C=O)c3)ccc2o1 |
| InChI | InChI=1S/C17H16N2O3/c1-2-18-17-19-15-9-13(6-7-16(15)22-17)11-21-14-5-3-4-12(8-14)10-20/h3-10H,2,11H2,1H3,(H,18,19) |
| InChIKey | IKPGQFQNZLRMNZ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|