About 6-ethynyl-1H-indene
6-ethynyl-1H-indene (PubChem CID 151725384) has the molecular formula C11H8
and a molecular weight of 140.18 g/mol. Its IUPAC name is 6-ethynyl-1H-indene.
Molecular Properties
| Compound Name | 6-ethynyl-1H-indene |
| PubChem CID | 151725384 |
| Molecular Formula | C11H8 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.06 |
| IUPAC Name | 6-ethynyl-1H-indene |
| SMILES | C#Cc1ccc2c(c1)CC=C2 |
| InChI | InChI=1S/C11H8/c1-2-9-6-7-10-4-3-5-11(10)8-9/h1,3-4,6-8H,5H2 |
| InChIKey | RJLSIRYPJCWIPQ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-ethynyl-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethynyl-1H-indene?
The IUPAC name of 6-ethynyl-1H-indene (CID 151725384) is 6-ethynyl-1H-indene.
What is the SMILES notation for 6-ethynyl-1H-indene?
The canonical SMILES for 6-ethynyl-1H-indene is C#Cc1ccc2c(c1)CC=C2.
What is the InChIKey of 6-ethynyl-1H-indene?
The InChIKey is RJLSIRYPJCWIPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8/c1-2-9-6-7-10-4-3-5-11(10)8-9/h1,3-4,6-8H,5H2.
What are the key properties of 6-ethynyl-1H-indene?
6-ethynyl-1H-indene has a molecular weight of 140.18 g/mol, XLogP of 2.24, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethynyl-1H-indene is sourced from PubChem (CID 151725384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).