C16H27N3O6SSi — CID 151733581
4-[[3-[tert-butyl(dimethyl)silyl]oxyoxetan-3-yl]methylamino]-3-nitrobenzenesulfonamide (PubChem CID 151733581) has the molecular formula C16H27N3O6SSi and a molecular weight of 417.56 g/mol. Its IUPAC name is 4-[[3-[tert-butyl(dimethyl)silyl]oxyoxetan-3-yl]methylamino]-3-nitrobenzenesulfonamide.
| Compound Name | 4-[[3-[tert-butyl(dimethyl)silyl]oxyoxetan-3-yl]methylamino]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 151733581 |
| Molecular Formula | C16H27N3O6SSi |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 4-[[3-[tert-butyl(dimethyl)silyl]oxyoxetan-3-yl]methylamino]-3-nitrobenzenesulfonamide |
| SMILES | CC(C)(C)[Si](C)(C)OC1(CNc2ccc(S(N)(=O)=O)cc2[N+](=O)[O-])COC1 |
| InChI | InChI=1S/C16H27N3O6SSi/c1-15(2,3)27(4,5)25-16(10-24-11-16)9-18-13-7-6-12(26(17,22)23)8-14(13)19(20)21/h6-8,18H,9-11H2,1-5H3,(H2,17,22,23) |
| InChIKey | RLBJYUUFIYDQDR-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 133.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|